C39H47F2O13S- — CID 169027002
2-[5,5-bis[(4-oxoadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 169027002) has the molecular formula C39H47F2O13S- and a molecular weight of 793.85 g/mol. Its IUPAC name is 2-[5,5-bis[(4-oxoadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[5,5-bis[(4-oxoadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 169027002 |
| Molecular Formula | C39H47F2O13S- |
| Molecular Weight | 793.85 g/mol |
| Exact Mass | 793.27 |
| IUPAC Name | 2-[5,5-bis[(4-oxoadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxy-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | O=C1C2CC3CC1CC(C(=O)OCC1(COC(=O)C45CC6CC(C4)C(=O)C(C6)C5)COC4(OC1)C1CC5CC4CC(OC(=O)C(F)(F)S(=O)(=O)[O-])(C5)C1)(C3)C2 |
| InChI | InChI=1S/C39H48F2O13S/c40-39(41,55(47,48)49)33(46)54-37-9-22-5-27(14-37)38(28(6-22)15-37)52-18-34(19-53-38,16-50-31(44)35-7-20-1-23(10-35)29(42)24(2-20)11-35)17-51-32(45)36-8-21-3-25(12-36)30(43)26(4-21)13-36/h20-28H,1-19H2,(H,47,48,49)/p-1 |
| InChIKey | HGBVSOMLQWYFOT-UHFFFAOYSA-M |
| XLogP | 3.85 |
| TPSA | 188.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|