C22H24F8O11S — CID 118265137
2-[5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 118265137) has the molecular formula C22H24F8O11S and a molecular weight of 648.47 g/mol. Its IUPAC name is 2-[5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 118265137 |
| Molecular Formula | C22H24F8O11S |
| Molecular Weight | 648.47 g/mol |
| Exact Mass | 648.09 |
| IUPAC Name | 2-[5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OCC1(COC(=O)C(F)(F)F)COC2(OC1)C1CC3CC2CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C1)C(F)(F)F |
| InChI | InChI=1S/C22H24F8O11S/c23-19(24,42(34,35)36)10-39-14(31)18-3-11-1-12(4-18)20(13(2-11)5-18)40-8-17(9-41-20,6-37-15(32)21(25,26)27)7-38-16(33)22(28,29)30/h11-13H,1-10H2,(H,34,35,36) |
| InChIKey | OTYZQPZZRTZOKT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|