C16H25F2NO6S — CID 130312904
1,1-difluoro-2-[(3S)-4-hydroxy-4-(propylamino)adamantane-1-carbonyl]oxyethanesulfonic acid (PubChem CID 130312904) has the molecular formula C16H25F2NO6S and a molecular weight of 397.44 g/mol. Its IUPAC name is 1,1-difluoro-2-[(3S)-4-hydroxy-4-(propylamino)adamantane-1-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(3S)-4-hydroxy-4-(propylamino)adamantane-1-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 130312904 |
| Molecular Formula | C16H25F2NO6S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1,1-difluoro-2-[(3S)-4-hydroxy-4-(propylamino)adamantane-1-carbonyl]oxyethanesulfonic acid |
| SMILES | CCCNC1(O)C2CC3C[C@H]1CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C16H25F2NO6S/c1-2-3-19-16(21)11-4-10-5-12(16)8-14(6-10,7-11)13(20)25-9-15(17,18)26(22,23)24/h10-12,19,21H,2-9H2,1H3,(H,22,23,24)/t10?,11-,12?,14?,16?/m0/s1 |
| InChIKey | WFCQAZMQKNITHE-KGWVMYMGSA-N |
| XLogP | 1.52 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|