C13H16F2O5S — CID 139555906
1,1-difluoro-2-(tetracyclo[5.2.1.03,8.05,8]decane-5-carbonyloxy)ethanesulfonic acid (PubChem CID 139555906) has the molecular formula C13H16F2O5S and a molecular weight of 322.33 g/mol. Its IUPAC name is 1,1-difluoro-2-(tetracyclo[5.2.1.03,8.05,8]decane-5-carbonyloxy)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(tetracyclo[5.2.1.03,8.05,8]decane-5-carbonyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 139555906 |
| Molecular Formula | C13H16F2O5S |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1,1-difluoro-2-(tetracyclo[5.2.1.03,8.05,8]decane-5-carbonyloxy)ethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C12CC3CC4CC(C1)C32C4 |
| InChI | InChI=1S/C13H16F2O5S/c14-13(15,21(17,18)19)6-20-10(16)11-4-8-1-7-2-9(5-11)12(8,11)3-7/h7-9H,1-6H2,(H,17,18,19) |
| InChIKey | KQVRWCFFMRZYIG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|