C15H22F2O6S — CID 59440667
[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 4-ethyl-4-hydroxyadamantane-1-carboxylate (PubChem CID 59440667) has the molecular formula C15H22F2O6S and a molecular weight of 368.40 g/mol. Its IUPAC name is [2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 4-ethyl-4-hydroxyadamantane-1-carboxylate.
| Compound Name | [2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 4-ethyl-4-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 59440667 |
| Molecular Formula | C15H22F2O6S |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 4-ethyl-4-hydroxyadamantane-1-carboxylate |
| SMILES | CCC1(O)C2CC3CC1CC(C(=O)OCC(F)(F)SOOO)(C3)C2 |
| InChI | InChI=1S/C15H22F2O6S/c1-2-14(19)10-3-9-4-11(14)7-13(5-9,6-10)12(18)21-8-15(16,17)24-23-22-20/h9-11,19-20H,2-8H2,1H3 |
| InChIKey | WJQIMXKUIUAXFK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|