C25H34F2O9S — CID 58264812
[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 3-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]adamantane-1-carboxylate (PubChem CID 58264812) has the molecular formula C25H34F2O9S and a molecular weight of 548.60 g/mol. Its IUPAC name is [2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 3-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]adamantane-1-carboxylate.
| Compound Name | [2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 3-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 58264812 |
| Molecular Formula | C25H34F2O9S |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | [2,2-difluoro-2-(trioxidanylsulfanyl)ethyl] 3-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]adamantane-1-carboxylate |
| SMILES | O=C(COC12CC3CC(C1)CC(C(=O)OCC(F)(F)SOOO)(C3)C2)OC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C25H34F2O9S/c26-25(27,37-36-35-31)14-32-20(29)21-3-15-1-16(4-21)8-23(7-15,12-21)33-11-19(28)34-24-9-17-2-18(10-24)6-22(30,5-17)13-24/h15-18,30-31H,1-14H2 |
| InChIKey | PAMLSXXVIUOLTH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|