C21H24F6O6 — CID 137432341
[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate (PubChem CID 137432341) has the molecular formula C21H24F6O6 and a molecular weight of 486.41 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-(trifluoromethyl)propyl] 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate.
| Compound Name | [3,3,3-trifluoro-2-(trifluoromethyl)propyl] 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 137432341 |
| Molecular Formula | C21H24F6O6 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [3,3,3-trifluoro-2-(trifluoromethyl)propyl] 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC(=O)OC12CC3CC(C1)CC(C(=O)OCC(C(F)(F)F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C21H24F6O6/c1-11(2)16(29)31-9-15(28)33-19-6-12-3-13(7-19)5-18(4-12,10-19)17(30)32-8-14(20(22,23)24)21(25,26)27/h12-14H,1,3-10H2,2H3 |
| InChIKey | MZEPNJFCODNOBU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|