C28H40O8 — CID 70192145
bis[2-methyl-3-(2-methylprop-2-enoyloxy)propyl] adamantane-1,3-dicarboxylate (PubChem CID 70192145) has the molecular formula C28H40O8 and a molecular weight of 504.62 g/mol. Its IUPAC name is bis[2-methyl-3-(2-methylprop-2-enoyloxy)propyl] adamantane-1,3-dicarboxylate.
| Compound Name | bis[2-methyl-3-(2-methylprop-2-enoyloxy)propyl] adamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70192145 |
| Molecular Formula | C28H40O8 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | bis[2-methyl-3-(2-methylprop-2-enoyloxy)propyl] adamantane-1,3-dicarboxylate |
| SMILES | C=C(C)C(=O)OCC(C)COC(=O)C12CC3CC(C1)CC(C(=O)OCC(C)COC(=O)C(=C)C)(C3)C2 |
| InChI | InChI=1S/C28H40O8/c1-17(2)23(29)33-12-19(5)14-35-25(31)27-8-21-7-22(9-27)11-28(10-21,16-27)26(32)36-15-20(6)13-34-24(30)18(3)4/h19-22H,1,3,7-16H2,2,4-6H3 |
| InChIKey | DVLTVCQNVLJFCZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|