C19H25F2O7S- — CID 58372242
1,1-difluoro-2-[3-(2-methylprop-2-enoyloxymethyl)adamantane-1-carbonyl]oxypropane-1-sulfonate (PubChem CID 58372242) has the molecular formula C19H25F2O7S- and a molecular weight of 435.47 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-(2-methylprop-2-enoyloxymethyl)adamantane-1-carbonyl]oxypropane-1-sulfonate.
| Compound Name | 1,1-difluoro-2-[3-(2-methylprop-2-enoyloxymethyl)adamantane-1-carbonyl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 58372242 |
| Molecular Formula | C19H25F2O7S- |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1,1-difluoro-2-[3-(2-methylprop-2-enoyloxymethyl)adamantane-1-carbonyl]oxypropane-1-sulfonate |
| SMILES | C=C(C)C(=O)OCC12CC3CC(C1)CC(C(=O)OC(C)C(F)(F)S(=O)(=O)[O-])(C3)C2 |
| InChI | InChI=1S/C19H26F2O7S/c1-11(2)15(22)27-10-17-5-13-4-14(6-17)8-18(7-13,9-17)16(23)28-12(3)19(20,21)29(24,25)26/h12-14H,1,4-10H2,2-3H3,(H,24,25,26)/p-1 |
| InChIKey | XNCOKBZKPKQKSU-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|