C22H27F7O5 — CID 121323927
[3-[1-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-oxopropan-2-yl]oxy-1-adamantyl]methyl 2-methylprop-2-enoate (PubChem CID 121323927) has the molecular formula C22H27F7O5 and a molecular weight of 504.44 g/mol. Its IUPAC name is [3-[1-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-oxopropan-2-yl]oxy-1-adamantyl]methyl 2-methylprop-2-enoate.
| Compound Name | [3-[1-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-oxopropan-2-yl]oxy-1-adamantyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121323927 |
| Molecular Formula | C22H27F7O5 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | [3-[1-(2,2,3,3,4,4,4-heptafluorobutoxy)-1-oxopropan-2-yl]oxy-1-adamantyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC12CC3CC(C1)CC(OC(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C22H27F7O5/c1-12(2)16(30)32-10-18-5-14-4-15(6-18)8-19(7-14,9-18)34-13(3)17(31)33-11-20(23,24)21(25,26)22(27,28)29/h13-15H,1,4-11H2,2-3H3 |
| InChIKey | HMWNRWZDNPKLQD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|