C21H32F2O4 — CID 122692891
2-[1-[[3-(2,2-difluoroethyl)-1-adamantyl]methoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 122692891) has the molecular formula C21H32F2O4 and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-[1-[[3-(2,2-difluoroethyl)-1-adamantyl]methoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[1-[[3-(2,2-difluoroethyl)-1-adamantyl]methoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122692891 |
| Molecular Formula | C21H32F2O4 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-[1-[[3-(2,2-difluoroethyl)-1-adamantyl]methoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(C)OCC12CC3CC(C1)CC(CC(F)F)(C3)C2 |
| InChI | InChI=1S/C21H32F2O4/c1-14(2)19(24)26-5-4-25-15(3)27-13-21-9-16-6-17(10-21)8-20(7-16,12-21)11-18(22)23/h15-18H,1,4-13H2,2-3H3 |
| InChIKey | VUGNHDPJVANXFB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|