C23H35F2NaO7S — CID 140866198
sodium 4-[1-[[3-(2,2-difluoro-2-oxidoperoxysulfanylethyl)-1-adamantyl]methoxy]ethoxy]butyl 2-methylprop-2-enoate (PubChem CID 140866198) has the molecular formula C23H35F2NaO7S and a molecular weight of 516.58 g/mol. Its IUPAC name is sodium 4-[1-[[3-(2,2-difluoro-2-oxidoperoxysulfanylethyl)-1-adamantyl]methoxy]ethoxy]butyl 2-methylprop-2-enoate.
| Compound Name | sodium 4-[1-[[3-(2,2-difluoro-2-oxidoperoxysulfanylethyl)-1-adamantyl]methoxy]ethoxy]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140866198 |
| Molecular Formula | C23H35F2NaO7S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | sodium 4-[1-[[3-(2,2-difluoro-2-oxidoperoxysulfanylethyl)-1-adamantyl]methoxy]ethoxy]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOC(C)OCC12CC3CC(C1)CC(CC(F)(F)SOO[O-])(C3)C2.[Na+] |
| InChI | InChI=1S/C23H36F2O7S.Na/c1-16(2)20(26)29-7-5-4-6-28-17(3)30-15-22-11-18-8-19(12-22)10-21(9-18,13-22)14-23(24,25)33-32-31-27;/h17-19,27H,1,4-15H2,2-3H3;/q;+1/p-1 |
| InChIKey | MVRWVPGDINYLFJ-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|