C17H21F4O8S- — CID 59814175
[2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate (PubChem CID 59814175) has the molecular formula C17H21F4O8S- and a molecular weight of 461.41 g/mol. Its IUPAC name is [2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate.
| Compound Name | [2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate |
|---|---|
| PubChem CID | 59814175 |
| Molecular Formula | C17H21F4O8S- |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | [2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate |
| SMILES | O=C(COC(=O)C(F)(SOO[O-])C(F)(F)F)OCC12CC3CC(CC(CO)(C3)C1)C2 |
| InChI | InChI=1S/C17H22F4O8S/c18-16(17(19,20)21,30-29-28-25)13(24)26-6-12(23)27-9-15-4-10-1-11(5-15)3-14(2-10,7-15)8-22/h10-11,22,25H,1-9H2/p-1 |
| InChIKey | SJPLWJFCHOPYNY-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|