C18H22F6O8S — CID 59814326
[2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 3,3,3-trifluoro-2-(trifluoromethyl)-2-(trioxidanylsulfanyl)propanoate (PubChem CID 59814326) has the molecular formula C18H22F6O8S and a molecular weight of 512.42 g/mol. Its IUPAC name is [2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 3,3,3-trifluoro-2-(trifluoromethyl)-2-(trioxidanylsulfanyl)propanoate.
| Compound Name | [2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 3,3,3-trifluoro-2-(trifluoromethyl)-2-(trioxidanylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59814326 |
| Molecular Formula | C18H22F6O8S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | [2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethyl] 3,3,3-trifluoro-2-(trifluoromethyl)-2-(trioxidanylsulfanyl)propanoate |
| SMILES | O=C(COC(=O)C(SOOO)(C(F)(F)F)C(F)(F)F)OCC12CC3CC(CC(CO)(C3)C1)C2 |
| InChI | InChI=1S/C18H22F6O8S/c19-17(20,21)16(18(22,23)24,33-32-31-28)13(27)29-6-12(26)30-9-15-4-10-1-11(5-15)3-14(2-10,7-15)8-25/h10-11,25,28H,1-9H2 |
| InChIKey | RAMDXWAWUNNDIM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|