C23H32F2O9S — CID 59814228
[3-[[2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyacetyl]oxymethyl]-1-adamantyl]methyl cyclohexanecarboxylate (PubChem CID 59814228) has the molecular formula C23H32F2O9S and a molecular weight of 522.56 g/mol. Its IUPAC name is [3-[[2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyacetyl]oxymethyl]-1-adamantyl]methyl cyclohexanecarboxylate.
| Compound Name | [3-[[2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyacetyl]oxymethyl]-1-adamantyl]methyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 59814228 |
| Molecular Formula | C23H32F2O9S |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [3-[[2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyacetyl]oxymethyl]-1-adamantyl]methyl cyclohexanecarboxylate |
| SMILES | O=C(COC(=O)C(F)(F)SOOO)OCC12CC3CC(C1)CC(COC(=O)C1CCCCC1)(C3)C2 |
| InChI | InChI=1S/C23H32F2O9S/c24-23(25,35-34-33-29)20(28)30-11-18(26)31-13-21-7-15-6-16(8-21)10-22(9-15,12-21)14-32-19(27)17-4-2-1-3-5-17/h15-17,29H,1-14H2 |
| InChIKey | CEUQEKJRTYOSTM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|