C23H34F2O6S — CID 59839354
[3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 59839354) has the molecular formula C23H34F2O6S and a molecular weight of 476.58 g/mol. Its IUPAC name is [3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-propan-2-ylcyclohexane-1-carboxylate.
| Compound Name | [3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-propan-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59839354 |
| Molecular Formula | C23H34F2O6S |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [3-[(2,2-difluoro-2-hydroperoxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CC(C)C1CCC(C(=O)OC23CC4CC(CC(COC(=O)C(F)(F)SOO)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C23H34F2O6S/c1-14(2)17-3-5-18(6-4-17)19(26)30-22-10-15-7-16(11-22)9-21(8-15,12-22)13-29-20(27)23(24,25)32-31-28/h14-18,28H,3-13H2,1-2H3 |
| InChIKey | LCPBALJWOODWGH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|