C20H24F2O5S — CID 59839277
[3-(4-methoxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate (PubChem CID 59839277) has the molecular formula C20H24F2O5S and a molecular weight of 414.47 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate.
| Compound Name | [3-(4-methoxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate |
|---|---|
| PubChem CID | 59839277 |
| Molecular Formula | C20H24F2O5S |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [3-(4-methoxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate |
| SMILES | COc1ccc(C23CC4CC(CC(COC(=O)C(F)(F)SOO)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H24F2O5S/c1-25-16-4-2-15(3-5-16)19-9-13-6-14(10-19)8-18(7-13,11-19)12-26-17(23)20(21,22)28-27-24/h2-5,13-14,24H,6-12H2,1H3 |
| InChIKey | URYZXRMXKARNDV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|