C18H23NO2 — CID 98079985
(5S,7S)-3-(4-methoxyphenyl)adamantane-1-carboxamide (PubChem CID 98079985) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (5S,7S)-3-(4-methoxyphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-(4-methoxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98079985 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (5S,7S)-3-(4-methoxyphenyl)adamantane-1-carboxamide |
| SMILES | COc1ccc(C23C[C@@H]4C[C@H](CC(C(N)=O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-21-15-4-2-14(3-5-15)17-7-12-6-13(8-17)10-18(9-12,11-17)16(19)20/h2-5,12-13H,6-11H2,1H3,(H2,19,20)/t12-,13-,17?,18?/m0/s1 |
| InChIKey | JWCMLJPGQQVNTI-AGCBMJJTSA-N |
| XLogP | 3.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |