C21H29NO2 — CID 98138085
(5R,7R)-3-(4-methoxyphenyl)-N-propan-2-yladamantane-1-carboxamide (PubChem CID 98138085) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (5R,7R)-3-(4-methoxyphenyl)-N-propan-2-yladamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-(4-methoxyphenyl)-N-propan-2-yladamantane-1-carboxamide |
|---|---|
| PubChem CID | 98138085 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (5R,7R)-3-(4-methoxyphenyl)-N-propan-2-yladamantane-1-carboxamide |
| SMILES | COc1ccc(C23C[C@H]4C[C@@H](CC(C(=O)NC(C)C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-14(2)22-19(23)21-11-15-8-16(12-21)10-20(9-15,13-21)17-4-6-18(24-3)7-5-17/h4-7,14-16H,8-13H2,1-3H3,(H,22,23)/t15-,16-,20?,21?/m1/s1 |
| InChIKey | QBXCGSSUJJREPT-AJHHTPGJSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |