C21H24N2O2S — CID 24536593
3-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide (PubChem CID 24536593) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 24536593 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide |
| SMILES | COc1ccc(C23CC4CC(CC(C(=O)Nc5nccs5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-25-17-4-2-16(3-5-17)20-9-14-8-15(10-20)12-21(11-14,13-20)18(24)23-19-22-6-7-26-19/h2-7,14-15H,8-13H2,1H3,(H,22,23,24) |
| InChIKey | DOEHRBCNLPMGPI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |