C16H21N3O2S — CID 2999599
3-acetamido-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide (PubChem CID 2999599) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-acetamido-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | 3-acetamido-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 2999599 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-acetamido-N-(1,3-thiazol-2-yl)adamantane-1-carboxamide |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C(=O)Nc1nccs1)(C3)C2 |
| InChI | InChI=1S/C16H21N3O2S/c1-10(20)19-16-7-11-4-12(8-16)6-15(5-11,9-16)13(21)18-14-17-2-3-22-14/h2-3,11-12H,4-9H2,1H3,(H,19,20)(H,17,18,21) |
| InChIKey | PTRYZAWRJXRCJV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |