C23H28N4O2 — CID 98215106
(5R,7R)-3-acetamido-N-[4-(3-methylpyrazol-1-yl)phenyl]adamantane-1-carboxamide (PubChem CID 98215106) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (5R,7R)-3-acetamido-N-[4-(3-methylpyrazol-1-yl)phenyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-acetamido-N-[4-(3-methylpyrazol-1-yl)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98215106 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (5R,7R)-3-acetamido-N-[4-(3-methylpyrazol-1-yl)phenyl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12C[C@@H]3C[C@@H](C1)CC(C(=O)Nc1ccc(-n4ccc(C)n4)cc1)(C3)C2 |
| InChI | InChI=1S/C23H28N4O2/c1-15-7-8-27(26-15)20-5-3-19(4-6-20)24-21(29)22-10-17-9-18(11-22)13-23(12-17,14-22)25-16(2)28/h3-8,17-18H,9-14H2,1-2H3,(H,24,29)(H,25,28)/t17-,18-,22?,23?/m1/s1 |
| InChIKey | BOXBJOORCRUKLG-YUOVDFJASA-N |
| XLogP | 3.59 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |