C24H31N3O — CID 3127225
3-(1-adamantyl)-N,N-diethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 3127225) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-(1-adamantyl)-N,N-diethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(1-adamantyl)-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 3127225 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 3-(1-adamantyl)-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cn(-c2ccccc2)nc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31N3O/c1-3-26(4-2)23(28)21-16-27(20-8-6-5-7-9-20)25-22(21)24-13-17-10-18(14-24)12-19(11-17)15-24/h5-9,16-19H,3-4,10-15H2,1-2H3 |
| InChIKey | YLLAXADQRSHOST-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |