C22H23N3O — CID 4799063
2-(1,3-diphenylpyrazol-4-yl)-1-piperidin-1-ylethanone (PubChem CID 4799063) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)-1-piperidin-1-ylethanone.
| Compound Name | 2-(1,3-diphenylpyrazol-4-yl)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 4799063 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-(1,3-diphenylpyrazol-4-yl)-1-piperidin-1-ylethanone |
| SMILES | O=C(Cc1cn(-c2ccccc2)nc1-c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C22H23N3O/c26-21(24-14-8-3-9-15-24)16-19-17-25(20-12-6-2-7-13-20)23-22(19)18-10-4-1-5-11-18/h1-2,4-7,10-13,17H,3,8-9,14-16H2 |
| InChIKey | QELFRBJVLDCBNV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |