C23H19N3O — CID 3510494
N-(3-methylphenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 3510494) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is N-(3-methylphenyl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(3-methylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 3510494 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-(3-methylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H19N3O/c1-17-9-8-12-19(15-17)24-23(27)21-16-26(20-13-6-3-7-14-20)25-22(21)18-10-4-2-5-11-18/h2-16H,1H3,(H,24,27) |
| InChIKey | ALCYRTJAWJYDPJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |