C26H27N5O — CID 25158261
N-(2-amino-5-phenylphenyl)-4-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]benzamide (PubChem CID 25158261) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 25158261 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]benzamide |
| SMILES | Cc1c(CNCc2ccc(C(=O)Nc3cc(-c4ccccc4)ccc3N)cc2)cnn1C |
| InChI | InChI=1S/C26H27N5O/c1-18-23(17-29-31(18)2)16-28-15-19-8-10-21(11-9-19)26(32)30-25-14-22(12-13-24(25)27)20-6-4-3-5-7-20/h3-14,17,28H,15-16,27H2,1-2H3,(H,30,32) |
| InChIKey | ZGGMUNJMGPPDEV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|