C23H27N3O2S — CID 17485108
3-acetamido-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]adamantane-1-carboxamide (PubChem CID 17485108) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 3-acetamido-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]adamantane-1-carboxamide.
| Compound Name | 3-acetamido-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 17485108 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 3-acetamido-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C(=O)NCc1csc(-c4ccccc4)n1)(C3)C2 |
| InChI | InChI=1S/C23H27N3O2S/c1-15(27)26-23-10-16-7-17(11-23)9-22(8-16,14-23)21(28)24-12-19-13-29-20(25-19)18-5-3-2-4-6-18/h2-6,13,16-17H,7-12,14H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | YBNQRYSSUIFNBA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |