C21H25F3N2O2 — CID 98408155
(5R,7R)-3-acetamido-N-[[3-(trifluoromethyl)phenyl]methyl]adamantane-1-carboxamide (PubChem CID 98408155) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is (5R,7R)-3-acetamido-N-[[3-(trifluoromethyl)phenyl]methyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-acetamido-N-[[3-(trifluoromethyl)phenyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98408155 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (5R,7R)-3-acetamido-N-[[3-(trifluoromethyl)phenyl]methyl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12C[C@@H]3C[C@@H](C1)CC(C(=O)NCc1cccc(C(F)(F)F)c1)(C3)C2 |
| InChI | InChI=1S/C21H25F3N2O2/c1-13(27)26-20-9-15-5-16(10-20)8-19(7-15,12-20)18(28)25-11-14-3-2-4-17(6-14)21(22,23)24/h2-4,6,15-16H,5,7-12H2,1H3,(H,25,28)(H,26,27)/t15-,16-,19?,20?/m1/s1 |
| InChIKey | AEIZZSXIVOWYIL-JZFKGDSASA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |