C21H28N2O3 — CID 98422119
(5R,7R)-3-acetamido-N-[(4-methoxyphenyl)methyl]adamantane-1-carboxamide (PubChem CID 98422119) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (5R,7R)-3-acetamido-N-[(4-methoxyphenyl)methyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-acetamido-N-[(4-methoxyphenyl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98422119 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (5R,7R)-3-acetamido-N-[(4-methoxyphenyl)methyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)C23C[C@H]4C[C@@H](CC(NC(C)=O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H28N2O3/c1-14(24)23-21-10-16-7-17(11-21)9-20(8-16,13-21)19(25)22-12-15-3-5-18(26-2)6-4-15/h3-6,16-17H,7-13H2,1-2H3,(H,22,25)(H,23,24)/t16-,17-,20?,21?/m1/s1 |
| InChIKey | ZGEBHJTYWGYOBS-FBIZOPLVSA-N |
| XLogP | 2.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |