C22H30N2O3 — CID 4028517
N'-(1-adamantyl)-N-[(4-methoxyphenyl)methyl]butanediamide (PubChem CID 4028517) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is N'-(1-adamantyl)-N-[(4-methoxyphenyl)methyl]butanediamide.
| Compound Name | N'-(1-adamantyl)-N-[(4-methoxyphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 4028517 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | N'-(1-adamantyl)-N-[(4-methoxyphenyl)methyl]butanediamide |
| SMILES | COc1ccc(CNC(=O)CCC(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H30N2O3/c1-27-19-4-2-15(3-5-19)14-23-20(25)6-7-21(26)24-22-11-16-8-17(12-22)10-18(9-16)13-22/h2-5,16-18H,6-14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | ZUDDPBJIFXBTHR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |