C23H31N3O4 — CID 2876720
(4-methoxyphenyl)methyl N-[[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]carbamate (PubChem CID 2876720) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 2876720 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[[4-(1-adamantylamino)-4-oxobutan-2-ylidene]amino]carbamate |
| SMILES | COc1ccc(COC(=O)NN=C(C)CC(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H31N3O4/c1-15(25-26-22(28)30-14-16-3-5-20(29-2)6-4-16)7-21(27)24-23-11-17-8-18(12-23)10-19(9-17)13-23/h3-6,17-19H,7-14H2,1-2H3,(H,24,27)(H,26,28) |
| InChIKey | SUKPTOOACCSSCY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|