C25H26N4O4 — CID 6382636
(4-methoxyphenyl)methyl N-[(Z)-[4-(4-anilinoanilino)-4-oxobutan-2-ylidene]amino]carbamate (PubChem CID 6382636) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[(Z)-[4-(4-anilinoanilino)-4-oxobutan-2-ylidene]amino]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[(Z)-[4-(4-anilinoanilino)-4-oxobutan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 6382636 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[(Z)-[4-(4-anilinoanilino)-4-oxobutan-2-ylidene]amino]carbamate |
| SMILES | COc1ccc(COC(=O)N/N=C(/C)CC(=O)Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-18(28-29-25(31)33-17-19-8-14-23(32-2)15-9-19)16-24(30)27-22-12-10-21(11-13-22)26-20-6-4-3-5-7-20/h3-15,26H,16-17H2,1-2H3,(H,27,30)(H,29,31)/b28-18- |
| InChIKey | UAZLFAXAZVBKLQ-VEILYXNESA-N |
| XLogP | 5.07 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|