C20H22N4O6 — CID 46501559
(4-methoxyphenyl)methyl N-[(E)-[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]carbamate (PubChem CID 46501559) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[(E)-[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[(E)-[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 46501559 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[(E)-[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]carbamate |
| SMILES | COc1ccc(COC(=O)N/N=C(\C)CC(=O)Nc2cc([N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C20H22N4O6/c1-13-4-7-16(24(27)28)11-18(13)21-19(25)10-14(2)22-23-20(26)30-12-15-5-8-17(29-3)9-6-15/h4-9,11H,10,12H2,1-3H3,(H,21,25)(H,23,26)/b22-14+ |
| InChIKey | WWDDPCDJQYQLRP-HYARGMPZSA-N |
| XLogP | 3.54 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|