C20H21N5O5 — CID 3615237
4-acetamido-N-[[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]cyclohexa-1,2,4-triene-1-carboxamide (PubChem CID 3615237) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 4-acetamido-N-[[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]cyclohexa-1,2,4-triene-1-carboxamide.
| Compound Name | 4-acetamido-N-[[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]cyclohexa-1,2,4-triene-1-carboxamide |
|---|---|
| PubChem CID | 3615237 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-acetamido-N-[[4-(2-methyl-5-nitroanilino)-4-oxobutan-2-ylidene]amino]cyclohexa-1,2,4-triene-1-carboxamide |
| SMILES | CC(=O)NC1=CCC(C(=O)NN=C(C)CC(=O)Nc2cc([N+](=O)[O-])ccc2C)=C=C1 |
| InChI | InChI=1S/C20H21N5O5/c1-12-4-9-17(25(29)30)11-18(12)22-19(27)10-13(2)23-24-20(28)15-5-7-16(8-6-15)21-14(3)26/h4,7-9,11H,5,10H2,1-3H3,(H,21,26)(H,22,27)(H,24,28) |
| InChIKey | HNGPGRNBASYXNW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 142.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|