C24H21N5O6 — CID 171980690
(3E)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(2-phenylphenyl)butanamide (PubChem CID 171980690) has the molecular formula C24H21N5O6 and a molecular weight of 475.46 g/mol. Its IUPAC name is (3E)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(2-phenylphenyl)butanamide.
| Compound Name | (3E)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(2-phenylphenyl)butanamide |
|---|---|
| PubChem CID | 171980690 |
| Molecular Formula | C24H21N5O6 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (3E)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(2-phenylphenyl)butanamide |
| SMILES | C/C(CC(=O)Nc1ccccc1-c1ccccc1)=N\NC(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21N5O6/c1-16(13-23(30)25-21-10-6-5-9-20(21)17-7-3-2-4-8-17)26-27-24(31)14-18-11-12-19(28(32)33)15-22(18)29(34)35/h2-12,15H,13-14H2,1H3,(H,25,30)(H,27,31)/b26-16+ |
| InChIKey | DANMDZQEEISBGR-WGOQTCKBSA-N |
| XLogP | 4.23 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|