C17H17N5O7 — CID 98156361
(3Z)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide (PubChem CID 98156361) has the molecular formula C17H17N5O7 and a molecular weight of 403.35 g/mol. Its IUPAC name is (3Z)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide.
| Compound Name | (3Z)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 98156361 |
| Molecular Formula | C17H17N5O7 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (3Z)-3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide |
| SMILES | C/C(CC(=O)NCc1ccco1)=N/NC(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N5O7/c1-11(7-16(23)18-10-14-3-2-6-29-14)19-20-17(24)8-12-4-5-13(21(25)26)9-15(12)22(27)28/h2-6,9H,7-8,10H2,1H3,(H,18,23)(H,20,24)/b19-11- |
| InChIKey | WIUOVJFMHMTRMC-ODLFYWEKSA-N |
| XLogP | 1.84 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|