C19H23N3O5 — CID 6283145
(3Z)-3-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide (PubChem CID 6283145) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is (3Z)-3-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide.
| Compound Name | (3Z)-3-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 6283145 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (3Z)-3-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]-N-(furan-2-ylmethyl)butanamide |
| SMILES | COc1ccc(CC(=O)N/N=C(/C)CC(=O)NCc2ccco2)cc1OC |
| InChI | InChI=1S/C19H23N3O5/c1-13(9-18(23)20-12-15-5-4-8-27-15)21-22-19(24)11-14-6-7-16(25-2)17(10-14)26-3/h4-8,10H,9,11-12H2,1-3H3,(H,20,23)(H,22,24)/b21-13- |
| InChIKey | PCMKNTLWJTZZJV-BKUYFWCQSA-N |
| XLogP | 2.04 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|