C20H21N5O6 — CID 5202497
3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(1-phenylethyl)butanamide (PubChem CID 5202497) has the molecular formula C20H21N5O6 and a molecular weight of 427.42 g/mol. Its IUPAC name is 3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(1-phenylethyl)butanamide.
| Compound Name | 3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 5202497 |
| Molecular Formula | C20H21N5O6 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-[[2-(2,4-dinitrophenyl)acetyl]hydrazinylidene]-N-(1-phenylethyl)butanamide |
| SMILES | CC(CC(=O)NC(C)c1ccccc1)=NNC(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N5O6/c1-13(10-19(26)21-14(2)15-6-4-3-5-7-15)22-23-20(27)11-16-8-9-17(24(28)29)12-18(16)25(30)31/h3-9,12,14H,10-11H2,1-2H3,(H,21,26)(H,23,27) |
| InChIKey | SGCIGTVAHMFCTB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|