C19H20N4O5 — CID 6039314
2-(2,4-dinitrophenyl)-N-[(E)-1-phenylpentylideneamino]acetamide (PubChem CID 6039314) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-N-[(E)-1-phenylpentylideneamino]acetamide.
| Compound Name | 2-(2,4-dinitrophenyl)-N-[(E)-1-phenylpentylideneamino]acetamide |
|---|---|
| PubChem CID | 6039314 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-N-[(E)-1-phenylpentylideneamino]acetamide |
| SMILES | CCCC/C(=N\NC(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H20N4O5/c1-2-3-9-17(14-7-5-4-6-8-14)20-21-19(24)12-15-10-11-16(22(25)26)13-18(15)23(27)28/h4-8,10-11,13H,2-3,9,12H2,1H3,(H,21,24)/b20-17+ |
| InChIKey | IDYJJHHQXSHILA-LVZFUZTISA-N |
| XLogP | 3.76 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|