C20H21ClN4O4 — CID 3974829
2-chloro-4-nitro-N-[[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide (PubChem CID 3974829) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 3974829 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-chloro-4-nitro-N-[[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide |
| SMILES | CC(CC(=O)Nc1c(C)cc(C)cc1C)=NNC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H21ClN4O4/c1-11-7-12(2)19(13(3)8-11)22-18(26)9-14(4)23-24-20(27)16-6-5-15(25(28)29)10-17(16)21/h5-8,10H,9H2,1-4H3,(H,22,26)(H,24,27) |
| InChIKey | JGXXWYWZCRNHTD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|