C20H22IN3O2 — CID 46501048
4-iodo-N-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide (PubChem CID 46501048) has the molecular formula C20H22IN3O2 and a molecular weight of 463.32 g/mol. Its IUPAC name is 4-iodo-N-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide.
| Compound Name | 4-iodo-N-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 46501048 |
| Molecular Formula | C20H22IN3O2 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 4-iodo-N-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]benzamide |
| SMILES | C/C(CC(=O)Nc1c(C)cc(C)cc1C)=N\NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H22IN3O2/c1-12-9-13(2)19(14(3)10-12)22-18(25)11-15(4)23-24-20(26)16-5-7-17(21)8-6-16/h5-10H,11H2,1-4H3,(H,22,25)(H,24,26)/b23-15+ |
| InChIKey | PGRLNFUQXIHPAJ-HZHRSRAPSA-N |
| XLogP | 4.35 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|