C22H26N4O3 — CID 46502643
N-(4-methylphenyl)-N'-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]oxamide (PubChem CID 46502643) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]oxamide.
| Compound Name | N-(4-methylphenyl)-N'-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 46502643 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-(4-methylphenyl)-N'-[(E)-[4-oxo-4-(2,4,6-trimethylanilino)butan-2-ylidene]amino]oxamide |
| SMILES | C/C(CC(=O)Nc1c(C)cc(C)cc1C)=N\NC(=O)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-13-6-8-18(9-7-13)23-21(28)22(29)26-25-17(5)12-19(27)24-20-15(3)10-14(2)11-16(20)4/h6-11H,12H2,1-5H3,(H,23,28)(H,24,27)(H,26,29)/b25-17+ |
| InChIKey | ASDNBISASDEPOV-KOEQRZSOSA-N |
| XLogP | 3.38 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|