C19H26N4O3 — CID 3489844
N'-[[4-(cyclohexylamino)-4-oxobutan-2-ylidene]amino]-N-(4-methylphenyl)oxamide (PubChem CID 3489844) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N'-[[4-(cyclohexylamino)-4-oxobutan-2-ylidene]amino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[[4-(cyclohexylamino)-4-oxobutan-2-ylidene]amino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 3489844 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N'-[[4-(cyclohexylamino)-4-oxobutan-2-ylidene]amino]-N-(4-methylphenyl)oxamide |
| SMILES | CC(CC(=O)NC1CCCCC1)=NNC(=O)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H26N4O3/c1-13-8-10-16(11-9-13)21-18(25)19(26)23-22-14(2)12-17(24)20-15-6-4-3-5-7-15/h8-11,15H,3-7,12H2,1-2H3,(H,20,24)(H,21,25)(H,23,26) |
| InChIKey | PUKRBCBFNXFKMY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|