C22H30N4O3 — CID 2862074
N-cyclohexyl-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide (PubChem CID 2862074) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-cyclohexyl-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide.
| Compound Name | N-cyclohexyl-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 2862074 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-cyclohexyl-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide |
| SMILES | CC(CC(=O)Nc1cccc2c1CCCC2)=NNC(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H30N4O3/c1-15(25-26-22(29)21(28)23-17-10-3-2-4-11-17)14-20(27)24-19-13-7-9-16-8-5-6-12-18(16)19/h7,9,13,17H,2-6,8,10-12,14H2,1H3,(H,23,28)(H,24,27)(H,26,29) |
| InChIKey | SCQQFSRXDVXXHZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|