C23H26N4O3 — CID 3105655
N-(2-methylphenyl)-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide (PubChem CID 3105655) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-(2-methylphenyl)-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide.
| Compound Name | N-(2-methylphenyl)-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 3105655 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-(2-methylphenyl)-N'-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)butan-2-ylidene]amino]oxamide |
| SMILES | CC(CC(=O)Nc1cccc2c1CCCC2)=NNC(=O)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C23H26N4O3/c1-15-8-3-6-12-19(15)25-22(29)23(30)27-26-16(2)14-21(28)24-20-13-7-10-17-9-4-5-11-18(17)20/h3,6-8,10,12-13H,4-5,9,11,14H2,1-2H3,(H,24,28)(H,25,29)(H,27,30) |
| InChIKey | YZTHPODPUXFGIJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|