C12H16N2O — CID 24708933
2-amino-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 24708933) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-amino-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-amino-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 24708933 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-amino-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | NCC(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C12H16N2O/c13-8-12(15)14-11-7-3-5-9-4-1-2-6-10(9)11/h3,5,7H,1-2,4,6,8,13H2,(H,14,15) |
| InChIKey | UYXPAJJWOHLGFE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |