C14H21NO — CID 178170556
ethane;N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 178170556) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is ethane;N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | ethane;N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 178170556 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | ethane;N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CC.CC(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C12H15NO.C2H6/c1-9(14)13-12-8-4-6-10-5-2-3-7-11(10)12;1-2/h4,6,8H,2-3,5,7H2,1H3,(H,13,14);1-2H3 |
| InChIKey | XFOHNRFYOVDCCQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |