C18H19NO2 — CID 82782191
3-hydroxy-2-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 82782191) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 3-hydroxy-2-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 82782191 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-hydroxy-2-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | Cc1c(O)cccc1C(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C18H19NO2/c1-12-14(9-5-11-17(12)20)18(21)19-16-10-4-7-13-6-2-3-8-15(13)16/h4-5,7,9-11,20H,2-3,6,8H2,1H3,(H,19,21) |
| InChIKey | JNNCMMMWXRIZCY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |