C19H21NOS — CID 8795745
2-ethylsulfanyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 8795745) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 2-ethylsulfanyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 8795745 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-ethylsulfanyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | CCSc1ccccc1C(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C19H21NOS/c1-2-22-18-13-6-5-11-16(18)19(21)20-17-12-7-9-14-8-3-4-10-15(14)17/h5-7,9,11-13H,2-4,8,10H2,1H3,(H,20,21) |
| InChIKey | DSURAEZRZCSHHF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |