C11H13NO2 — CID 90481970
methyl N-(2,3-dihydro-1H-inden-4-yl)carbamate (PubChem CID 90481970) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl N-(2,3-dihydro-1H-inden-4-yl)carbamate.
| Compound Name | methyl N-(2,3-dihydro-1H-inden-4-yl)carbamate |
|---|---|
| PubChem CID | 90481970 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | methyl N-(2,3-dihydro-1H-inden-4-yl)carbamate |
| SMILES | COC(=O)Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C11H13NO2/c1-14-11(13)12-10-7-3-5-8-4-2-6-9(8)10/h3,5,7H,2,4,6H2,1H3,(H,12,13) |
| InChIKey | PJTWZHCRIYBHBF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |